C21H28N2O4 — CID 134927164
tert-butyl N-[(1R,2R)-1-[benzyl(hydroxy)amino]-3-hydroxy-1-phenylpropan-2-yl]carbamate (PubChem CID 134927164) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-1-[benzyl(hydroxy)amino]-3-hydroxy-1-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-1-[benzyl(hydroxy)amino]-3-hydroxy-1-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 134927164 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | tert-butyl N-[(1R,2R)-1-[benzyl(hydroxy)amino]-3-hydroxy-1-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)[C@@H](c1ccccc1)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C21H28N2O4/c1-21(2,3)27-20(25)22-18(15-24)19(17-12-8-5-9-13-17)23(26)14-16-10-6-4-7-11-16/h4-13,18-19,24,26H,14-15H2,1-3H3,(H,22,25)/t18-,19+/m0/s1 |
| InChIKey | VQDUQEOCDLQXTI-RBUKOAKNSA-N |
| XLogP | 3.50 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|