About (2S)-1-N,2-N-ditert-butyldecane-1,2-diamine
(2S)-1-N,2-N-ditert-butyldecane-1,2-diamine (PubChem CID 134927331) has the molecular formula C18H40N2
and a molecular weight of 284.53 g/mol. Its IUPAC name is (2S)-1-N,2-N-ditert-butyldecane-1,2-diamine.
Molecular Properties
| Compound Name | (2S)-1-N,2-N-ditert-butyldecane-1,2-diamine |
| PubChem CID | 134927331 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | (2S)-1-N,2-N-ditert-butyldecane-1,2-diamine |
| SMILES | CCCCCCCC[C@@H](CNC(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C18H40N2/c1-8-9-10-11-12-13-14-16(20-18(5,6)7)15-19-17(2,3)4/h16,19-20H,8-15H2,1-7H3/t16-/m0/s1 |
| InChIKey | GNDBJOKMCOVISC-INIZCTEOSA-N |
| XLogP | 4.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-N,2-N-ditert-butyldecane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-N,2-N-ditert-butyldecane-1,2-diamine?
The IUPAC name of (2S)-1-N,2-N-ditert-butyldecane-1,2-diamine (CID 134927331) is (2S)-1-N,2-N-ditert-butyldecane-1,2-diamine.
What is the SMILES notation for (2S)-1-N,2-N-ditert-butyldecane-1,2-diamine?
The canonical SMILES for (2S)-1-N,2-N-ditert-butyldecane-1,2-diamine is CCCCCCCC[C@@H](CNC(C)(C)C)NC(C)(C)C.
What is the InChIKey of (2S)-1-N,2-N-ditert-butyldecane-1,2-diamine?
The InChIKey is GNDBJOKMCOVISC-INIZCTEOSA-N. The full InChI is InChI=1S/C18H40N2/c1-8-9-10-11-12-13-14-16(20-18(5,6)7)15-19-17(2,3)4/h16,19-20H,8-15H2,1-7H3/t16-/m0/s1.
What are the key properties of (2S)-1-N,2-N-ditert-butyldecane-1,2-diamine?
(2S)-1-N,2-N-ditert-butyldecane-1,2-diamine has a molecular weight of 284.53 g/mol, XLogP of 4.88, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-N,2-N-ditert-butyldecane-1,2-diamine is sourced from PubChem (CID 134927331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).