C20H24O4S — CID 134927398
(3R,4R,5S,6R)-6-(hydroxymethyl)-4,5-bis(phenylmethoxy)thian-3-ol (PubChem CID 134927398) has the molecular formula C20H24O4S and a molecular weight of 360.47 g/mol. Its IUPAC name is (3R,4R,5S,6R)-6-(hydroxymethyl)-4,5-bis(phenylmethoxy)thian-3-ol.
| Compound Name | (3R,4R,5S,6R)-6-(hydroxymethyl)-4,5-bis(phenylmethoxy)thian-3-ol |
|---|---|
| PubChem CID | 134927398 |
| Molecular Formula | C20H24O4S |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (3R,4R,5S,6R)-6-(hydroxymethyl)-4,5-bis(phenylmethoxy)thian-3-ol |
| SMILES | OC[C@H]1SCC(O)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H24O4S/c21-11-18-20(24-13-16-9-5-2-6-10-16)19(17(22)14-25-18)23-12-15-7-3-1-4-8-15/h1-10,17-22H,11-14H2/t17?,18-,19-,20-/m1/s1 |
| InChIKey | XICBCZSQZITQQR-PDZGYPDUSA-N |
| XLogP | 2.63 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |