C15H24F6O6S4 — CID 134927516
[1-[(E)-3-methyl-4-[1-(trifluoromethylsulfonyloxy)thiolan-1-yl]but-2-enyl]thiolan-1-yl] trifluoromethanesulfonate (PubChem CID 134927516) has the molecular formula C15H24F6O6S4 and a molecular weight of 542.61 g/mol. Its IUPAC name is [1-[(E)-3-methyl-4-[1-(trifluoromethylsulfonyloxy)thiolan-1-yl]but-2-enyl]thiolan-1-yl] trifluoromethanesulfonate.
| Compound Name | [1-[(E)-3-methyl-4-[1-(trifluoromethylsulfonyloxy)thiolan-1-yl]but-2-enyl]thiolan-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134927516 |
| Molecular Formula | C15H24F6O6S4 |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | [1-[(E)-3-methyl-4-[1-(trifluoromethylsulfonyloxy)thiolan-1-yl]but-2-enyl]thiolan-1-yl] trifluoromethanesulfonate |
| SMILES | C/C(=C\CS1(OS(=O)(=O)C(F)(F)F)CCCC1)CS1(OS(=O)(=O)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C15H24F6O6S4/c1-13(12-29(9-4-5-10-29)27-31(24,25)15(19,20)21)6-11-28(7-2-3-8-28)26-30(22,23)14(16,17)18/h6H,2-5,7-12H2,1H3/b13-6+ |
| InChIKey | FUHWXLFGYVVHMV-AWNIVKPZSA-N |
| XLogP | 4.69 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|