C20H17F8NO2S — CID 134927590
1-benzylsulfonyl-3,3,4,4,5,5,6,6-octafluoro-N-(4-methylphenyl)hexan-2-imine (PubChem CID 134927590) has the molecular formula C20H17F8NO2S and a molecular weight of 487.41 g/mol. Its IUPAC name is 1-benzylsulfonyl-3,3,4,4,5,5,6,6-octafluoro-N-(4-methylphenyl)hexan-2-imine.
| Compound Name | 1-benzylsulfonyl-3,3,4,4,5,5,6,6-octafluoro-N-(4-methylphenyl)hexan-2-imine |
|---|---|
| PubChem CID | 134927590 |
| Molecular Formula | C20H17F8NO2S |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 1-benzylsulfonyl-3,3,4,4,5,5,6,6-octafluoro-N-(4-methylphenyl)hexan-2-imine |
| SMILES | Cc1ccc(/N=C(/CS(=O)(=O)Cc2ccccc2)C(F)(F)C(F)(F)C(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C20H17F8NO2S/c1-13-7-9-15(10-8-13)29-16(12-32(30,31)11-14-5-3-2-4-6-14)18(23,24)20(27,28)19(25,26)17(21)22/h2-10,17H,11-12H2,1H3/b29-16- |
| InChIKey | JUFPKCOCVRJTKP-MWLSYYOVSA-N |
| XLogP | 5.85 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|