2-piperidin-2-ylethanesulfonyl chloride

C7H14ClNO2S — CID 134927621

IUPAC2-piperidin-2-ylethanesulfonyl chloride
SMILESO=S(=O)(Cl)CCC1CCCCN1
InChIInChI=1S/C7H14ClNO2S/c8-12(10,11)6-4-7-3-1-2-5-9-7/h7,9H,1-6H2
InChIKeyJYACDWNXRZQGDV-UHFFFAOYSA-N
MW211.71 g/mol
LogP1.09
Rot. Bonds3

About 2-piperidin-2-ylethanesulfonyl chloride

2-piperidin-2-ylethanesulfonyl chloride (PubChem CID 134927621) has the molecular formula C7H14ClNO2S and a molecular weight of 211.71 g/mol. Its IUPAC name is 2-piperidin-2-ylethanesulfonyl chloride.

Molecular Properties

Compound Name2-piperidin-2-ylethanesulfonyl chloride
PubChem CID134927621
Molecular FormulaC7H14ClNO2S
Molecular Weight211.71 g/mol
Exact Mass211.04
IUPAC Name2-piperidin-2-ylethanesulfonyl chloride
SMILESO=S(=O)(Cl)CCC1CCCCN1
InChIInChI=1S/C7H14ClNO2S/c8-12(10,11)6-4-7-3-1-2-5-9-7/h7,9H,1-6H2
InChIKeyJYACDWNXRZQGDV-UHFFFAOYSA-N
XLogP1.09
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.71
LogP ≤ 51.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-piperidin-2-ylethanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-piperidin-2-ylethanesulfonyl chloride?
The IUPAC name of 2-piperidin-2-ylethanesulfonyl chloride (CID 134927621) is 2-piperidin-2-ylethanesulfonyl chloride.
What is the SMILES notation for 2-piperidin-2-ylethanesulfonyl chloride?
The canonical SMILES for 2-piperidin-2-ylethanesulfonyl chloride is O=S(=O)(Cl)CCC1CCCCN1.
What is the InChIKey of 2-piperidin-2-ylethanesulfonyl chloride?
The InChIKey is JYACDWNXRZQGDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14ClNO2S/c8-12(10,11)6-4-7-3-1-2-5-9-7/h7,9H,1-6H2.
What are the key properties of 2-piperidin-2-ylethanesulfonyl chloride?
2-piperidin-2-ylethanesulfonyl chloride has a molecular weight of 211.71 g/mol, XLogP of 1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-2-ylethanesulfonyl chloride is sourced from PubChem (CID 134927621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).