C6H5Cl2F8NO3S — CID 134927707
N-chloro-2-(2-chloro-1,1,2,2-tetrafluoroethoxy)-N-ethyl-1,1,2,2-tetrafluoroethanesulfonamide (PubChem CID 134927707) has the molecular formula C6H5Cl2F8NO3S and a molecular weight of 394.07 g/mol. Its IUPAC name is N-chloro-2-(2-chloro-1,1,2,2-tetrafluoroethoxy)-N-ethyl-1,1,2,2-tetrafluoroethanesulfonamide.
| Compound Name | N-chloro-2-(2-chloro-1,1,2,2-tetrafluoroethoxy)-N-ethyl-1,1,2,2-tetrafluoroethanesulfonamide |
|---|---|
| PubChem CID | 134927707 |
| Molecular Formula | C6H5Cl2F8NO3S |
| Molecular Weight | 394.07 g/mol |
| Exact Mass | 392.92 |
| IUPAC Name | N-chloro-2-(2-chloro-1,1,2,2-tetrafluoroethoxy)-N-ethyl-1,1,2,2-tetrafluoroethanesulfonamide |
| SMILES | CCN(Cl)S(=O)(=O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C6H5Cl2F8NO3S/c1-2-17(8)21(18,19)6(15,16)5(13,14)20-4(11,12)3(7,9)10/h2H2,1H3 |
| InChIKey | QWLBSRVAQSTXCT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.07 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|