C13H21ClO7S — CID 134927745
2-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]ethanesulfonyl chloride (PubChem CID 134927745) has the molecular formula C13H21ClO7S and a molecular weight of 356.82 g/mol. Its IUPAC name is 2-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]ethanesulfonyl chloride.
| Compound Name | 2-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]ethanesulfonyl chloride |
|---|---|
| PubChem CID | 134927745 |
| Molecular Formula | C13H21ClO7S |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]ethanesulfonyl chloride |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](CCS(=O)(=O)Cl)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C13H21ClO7S/c1-12(2)18-8-7(5-6-22(14,15)16)17-11-10(9(8)19-12)20-13(3,4)21-11/h7-11H,5-6H2,1-4H3/t7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | VKSBFJCGKVJWGR-ZKKRXERASA-N |
| XLogP | 1.34 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |