C10H20O2 — CID 134927759
(3S,4R)-3-hydroperoxy-2,4,5,5-tetramethylhex-1-ene (PubChem CID 134927759) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (3S,4R)-3-hydroperoxy-2,4,5,5-tetramethylhex-1-ene.
| Compound Name | (3S,4R)-3-hydroperoxy-2,4,5,5-tetramethylhex-1-ene |
|---|---|
| PubChem CID | 134927759 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (3S,4R)-3-hydroperoxy-2,4,5,5-tetramethylhex-1-ene |
| SMILES | C=C(C)[C@@H](OO)[C@H](C)C(C)(C)C |
| InChI | InChI=1S/C10H20O2/c1-7(2)9(12-11)8(3)10(4,5)6/h8-9,11H,1H2,2-6H3/t8-,9+/m0/s1 |
| InChIKey | LHNPEOXSUHOZKB-DTWKUNHWSA-N |
| XLogP | 3.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|