About diiodomercury;tribenzyl(iodo)-λ4-sulfane
diiodomercury;tribenzyl(iodo)-λ4-sulfane (PubChem CID 134927805) has the molecular formula C21H21HgI3S
and a molecular weight of 886.77 g/mol. Its IUPAC name is diiodomercury;tribenzyl(iodo)-λ4-sulfane.
Molecular Properties
| Compound Name | diiodomercury;tribenzyl(iodo)-λ4-sulfane |
| PubChem CID | 134927805 |
| Molecular Formula | C21H21HgI3S |
| Molecular Weight | 886.77 g/mol |
| Exact Mass | 887.82 |
| IUPAC Name | diiodomercury;tribenzyl(iodo)-λ4-sulfane |
| SMILES | IS(Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1.I[Hg]I |
| InChI | InChI=1S/C21H21IS.Hg.2HI/c22-23(16-19-10-4-1-5-11-19,17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21;;;/h1-15H,16-18H2;;2*1H/q;+2;;/p-2 |
| InChIKey | ZFPZJVORLUHLKD-UHFFFAOYSA-L |
| XLogP | 8.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 886.77 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diiodomercury;tribenzyl(iodo)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diiodomercury;tribenzyl(iodo)-λ4-sulfane?
The IUPAC name of diiodomercury;tribenzyl(iodo)-λ4-sulfane (CID 134927805) is diiodomercury;tribenzyl(iodo)-λ4-sulfane.
What is the SMILES notation for diiodomercury;tribenzyl(iodo)-λ4-sulfane?
The canonical SMILES for diiodomercury;tribenzyl(iodo)-λ4-sulfane is IS(Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1.I[Hg]I.
What is the InChIKey of diiodomercury;tribenzyl(iodo)-λ4-sulfane?
The InChIKey is ZFPZJVORLUHLKD-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H21IS.Hg.2HI/c22-23(16-19-10-4-1-5-11-19,17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21;;;/h1-15H,16-18H2;;2*1H/q;+2;;/p-2.
What are the key properties of diiodomercury;tribenzyl(iodo)-λ4-sulfane?
diiodomercury;tribenzyl(iodo)-λ4-sulfane has a molecular weight of 886.77 g/mol, XLogP of 8.51, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diiodomercury;tribenzyl(iodo)-λ4-sulfane is sourced from PubChem (CID 134927805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).