About methyl 9-octylsulfinylnonanoate
methyl 9-octylsulfinylnonanoate (PubChem CID 134927823) has the molecular formula C18H36O3S
and a molecular weight of 332.55 g/mol. Its IUPAC name is methyl 9-octylsulfinylnonanoate.
Molecular Properties
| Compound Name | methyl 9-octylsulfinylnonanoate |
| PubChem CID | 134927823 |
| Molecular Formula | C18H36O3S |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | methyl 9-octylsulfinylnonanoate |
| SMILES | CCCCCCCCS(=O)CCCCCCCCC(=O)OC |
| InChI | InChI=1S/C18H36O3S/c1-3-4-5-6-10-13-16-22(20)17-14-11-8-7-9-12-15-18(19)21-2/h3-17H2,1-2H3 |
| InChIKey | PIXUGEAQRAOOMS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 9-octylsulfinylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-octylsulfinylnonanoate?
The IUPAC name of methyl 9-octylsulfinylnonanoate (CID 134927823) is methyl 9-octylsulfinylnonanoate.
What is the SMILES notation for methyl 9-octylsulfinylnonanoate?
The canonical SMILES for methyl 9-octylsulfinylnonanoate is CCCCCCCCS(=O)CCCCCCCCC(=O)OC.
What is the InChIKey of methyl 9-octylsulfinylnonanoate?
The InChIKey is PIXUGEAQRAOOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O3S/c1-3-4-5-6-10-13-16-22(20)17-14-11-8-7-9-12-15-18(19)21-2/h3-17H2,1-2H3.
What are the key properties of methyl 9-octylsulfinylnonanoate?
methyl 9-octylsulfinylnonanoate has a molecular weight of 332.55 g/mol, XLogP of 5.00, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-octylsulfinylnonanoate is sourced from PubChem (CID 134927823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).