About (1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol
(1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol (PubChem CID 134927869) has the molecular formula C17H17BrO3S
and a molecular weight of 381.29 g/mol. Its IUPAC name is (1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol.
Molecular Properties
| Compound Name | (1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol |
| PubChem CID | 134927869 |
| Molecular Formula | C17H17BrO3S |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | (1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol |
| SMILES | CC1(O)OO[C@@](C)(CSc2ccc(Br)cc2)c2ccccc21 |
| InChI | InChI=1S/C17H17BrO3S/c1-16(11-22-13-9-7-12(18)8-10-13)14-5-3-4-6-15(14)17(2,19)21-20-16/h3-10,19H,11H2,1-2H3/t16-,17?/m0/s1 |
| InChIKey | DGHRGCUGSYUSBA-BHWOMJMDSA-N |
| XLogP | 4.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol?
The IUPAC name of (1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol (CID 134927869) is (1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol.
What is the SMILES notation for (1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol?
The canonical SMILES for (1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol is CC1(O)OO[C@@](C)(CSc2ccc(Br)cc2)c2ccccc21.
What is the InChIKey of (1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol?
The InChIKey is DGHRGCUGSYUSBA-BHWOMJMDSA-N. The full InChI is InChI=1S/C17H17BrO3S/c1-16(11-22-13-9-7-12(18)8-10-13)14-5-3-4-6-15(14)17(2,19)21-20-16/h3-10,19H,11H2,1-2H3/t16-,17?/m0/s1.
What are the key properties of (1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol?
(1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol has a molecular weight of 381.29 g/mol, XLogP of 4.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[(4-bromophenyl)sulfanylmethyl]-1,4-dimethyl-2,3-benzodioxin-4-ol is sourced from PubChem (CID 134927869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).