About tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate
tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate (PubChem CID 134927873) has the molecular formula C10H16O6
and a molecular weight of 232.23 g/mol. Its IUPAC name is tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate.
Molecular Properties
| Compound Name | tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate |
| PubChem CID | 134927873 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate |
| SMILES | CO/C=C/C(=O)C(=O)C(=O)OC(C)(C)C.O |
| InChI | InChI=1S/C10H14O5.H2O/c1-10(2,3)15-9(13)8(12)7(11)5-6-14-4;/h5-6H,1-4H3;1H2/b6-5+; |
| InChIKey | LGRUQMGUSLJNHV-IPZCTEOASA-N |
| XLogP | -0.20 |
| TPSA | 101.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate?
The IUPAC name of tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate (CID 134927873) is tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate.
What is the SMILES notation for tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate?
The canonical SMILES for tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate is CO/C=C/C(=O)C(=O)C(=O)OC(C)(C)C.O.
What is the InChIKey of tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate?
The InChIKey is LGRUQMGUSLJNHV-IPZCTEOASA-N. The full InChI is InChI=1S/C10H14O5.H2O/c1-10(2,3)15-9(13)8(12)7(11)5-6-14-4;/h5-6H,1-4H3;1H2/b6-5+;.
What are the key properties of tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate?
tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate has a molecular weight of 232.23 g/mol, XLogP of -0.20, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate;hydrate is sourced from PubChem (CID 134927873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).