C15H16O3 — CID 134927955
(1S,10S,12S)-8,12-dimethyl-11,13,14-trioxatetracyclo[10.2.2.01,10.02,7]hexadeca-2,4,6,8-tetraene (PubChem CID 134927955) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (1S,10S,12S)-8,12-dimethyl-11,13,14-trioxatetracyclo[10.2.2.01,10.02,7]hexadeca-2,4,6,8-tetraene.
| Compound Name | (1S,10S,12S)-8,12-dimethyl-11,13,14-trioxatetracyclo[10.2.2.01,10.02,7]hexadeca-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 134927955 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (1S,10S,12S)-8,12-dimethyl-11,13,14-trioxatetracyclo[10.2.2.01,10.02,7]hexadeca-2,4,6,8-tetraene |
| SMILES | CC1=C[C@@H]2O[C@]3(C)CC[C@]2(OO3)c2ccccc21 |
| InChI | InChI=1S/C15H16O3/c1-10-9-13-15(12-6-4-3-5-11(10)12)8-7-14(2,16-13)17-18-15/h3-6,9,13H,7-8H2,1-2H3/t13-,14-,15-/m0/s1 |
| InChIKey | OFVMPCPRJHGRJZ-KKUMJFAQSA-N |
| XLogP | 3.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|