About 2-methylpropyl propane-1-sulfinate
2-methylpropyl propane-1-sulfinate (PubChem CID 134928022) has the molecular formula C7H16O2S
and a molecular weight of 164.27 g/mol. Its IUPAC name is 2-methylpropyl propane-1-sulfinate.
Molecular Properties
| Compound Name | 2-methylpropyl propane-1-sulfinate |
| PubChem CID | 134928022 |
| Molecular Formula | C7H16O2S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2-methylpropyl propane-1-sulfinate |
| SMILES | CCCS(=O)OCC(C)C |
| InChI | InChI=1S/C7H16O2S/c1-4-5-10(8)9-6-7(2)3/h7H,4-6H2,1-3H3 |
| InChIKey | PMAFBNLXSNSIQU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropyl propane-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl propane-1-sulfinate?
The IUPAC name of 2-methylpropyl propane-1-sulfinate (CID 134928022) is 2-methylpropyl propane-1-sulfinate.
What is the SMILES notation for 2-methylpropyl propane-1-sulfinate?
The canonical SMILES for 2-methylpropyl propane-1-sulfinate is CCCS(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl propane-1-sulfinate?
The InChIKey is PMAFBNLXSNSIQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2S/c1-4-5-10(8)9-6-7(2)3/h7H,4-6H2,1-3H3.
What are the key properties of 2-methylpropyl propane-1-sulfinate?
2-methylpropyl propane-1-sulfinate has a molecular weight of 164.27 g/mol, XLogP of 1.73, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl propane-1-sulfinate is sourced from PubChem (CID 134928022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).