About (3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane
(3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane (PubChem CID 134928165) has the molecular formula C10H19IO
and a molecular weight of 282.17 g/mol. Its IUPAC name is (3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane.
Molecular Properties
| Compound Name | (3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane |
| PubChem CID | 134928165 |
| Molecular Formula | C10H19IO |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | (3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane |
| SMILES | CCCC[C@H](I)C1O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C10H19IO/c1-4-5-6-9(11)10-7(2)8(3)12-10/h7-10H,4-6H2,1-3H3/t7-,8+,9-,10?/m0/s1 |
| InChIKey | BKIXOTHDLVLSLC-GFMAATOTSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane?
The IUPAC name of (3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane (CID 134928165) is (3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane.
What is the SMILES notation for (3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane?
The canonical SMILES for (3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane is CCCC[C@H](I)C1O[C@H](C)[C@@H]1C.
What is the InChIKey of (3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane?
The InChIKey is BKIXOTHDLVLSLC-GFMAATOTSA-N. The full InChI is InChI=1S/C10H19IO/c1-4-5-6-9(11)10-7(2)8(3)12-10/h7-10H,4-6H2,1-3H3/t7-,8+,9-,10?/m0/s1.
What are the key properties of (3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane?
(3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane has a molecular weight of 282.17 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-2-[(1S)-1-iodopentyl]-3,4-dimethyloxetane is sourced from PubChem (CID 134928165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).