About (1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol
(1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol (PubChem CID 134928244) has the molecular formula C13H18O2S
and a molecular weight of 238.35 g/mol. Its IUPAC name is (1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol.
Molecular Properties
| Compound Name | (1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol |
| PubChem CID | 134928244 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol |
| SMILES | CCC[C@@H](O)[C@H]1CO[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C13H18O2S/c1-2-6-12(14)11-9-15-13(11)16-10-7-4-3-5-8-10/h3-5,7-8,11-14H,2,6,9H2,1H3/t11-,12-,13-/m1/s1 |
| InChIKey | HJZQSVPJVPJHMJ-JHJVBQTASA-N |
| XLogP | 2.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol?
The IUPAC name of (1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol (CID 134928244) is (1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol.
What is the SMILES notation for (1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol?
The canonical SMILES for (1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol is CCC[C@@H](O)[C@H]1CO[C@@H]1Sc1ccccc1.
What is the InChIKey of (1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol?
The InChIKey is HJZQSVPJVPJHMJ-JHJVBQTASA-N. The full InChI is InChI=1S/C13H18O2S/c1-2-6-12(14)11-9-15-13(11)16-10-7-4-3-5-8-10/h3-5,7-8,11-14H,2,6,9H2,1H3/t11-,12-,13-/m1/s1.
What are the key properties of (1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol?
(1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol has a molecular weight of 238.35 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[(2R,3R)-2-phenylsulfanyloxetan-3-yl]butan-1-ol is sourced from PubChem (CID 134928244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).