C19H36O — CID 134928245
(2S,6S)-2,6-diheptyl-3,6-dihydro-2H-pyran (PubChem CID 134928245) has the molecular formula C19H36O and a molecular weight of 280.50 g/mol. Its IUPAC name is (2S,6S)-2,6-diheptyl-3,6-dihydro-2H-pyran.
| Compound Name | (2S,6S)-2,6-diheptyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 134928245 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | (2S,6S)-2,6-diheptyl-3,6-dihydro-2H-pyran |
| SMILES | CCCCCCC[C@H]1CC=C[C@H](CCCCCCC)O1 |
| InChI | InChI=1S/C19H36O/c1-3-5-7-9-11-14-18-16-13-17-19(20-18)15-12-10-8-6-4-2/h13,16,18-19H,3-12,14-15,17H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | HPEQUVCAZLZPDJ-OALUTQOASA-N |
| XLogP | 6.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|