C8H15NO4S — CID 134928400
1-[(4R,5S)-5-hydroperoxy-3-(hydroxymethyl)-2,2-dimethyl-1,3-thiazolidin-4-yl]ethanone (PubChem CID 134928400) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is 1-[(4R,5S)-5-hydroperoxy-3-(hydroxymethyl)-2,2-dimethyl-1,3-thiazolidin-4-yl]ethanone.
| Compound Name | 1-[(4R,5S)-5-hydroperoxy-3-(hydroxymethyl)-2,2-dimethyl-1,3-thiazolidin-4-yl]ethanone |
|---|---|
| PubChem CID | 134928400 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 1-[(4R,5S)-5-hydroperoxy-3-(hydroxymethyl)-2,2-dimethyl-1,3-thiazolidin-4-yl]ethanone |
| SMILES | CC(=O)[C@@H]1[C@@H](OO)SC(C)(C)N1CO |
| InChI | InChI=1S/C8H15NO4S/c1-5(11)6-7(13-12)14-8(2,3)9(6)4-10/h6-7,10,12H,4H2,1-3H3/t6-,7+/m1/s1 |
| InChIKey | GFMSJKIPXXRXND-RQJHMYQMSA-N |
| XLogP | 0.49 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|