C17H23NO4S — CID 134928532
ethyl (3S,4R)-2-benzyl-4-propylsulfanylcarbonyl-1,2-oxazolidine-3-carboxylate (PubChem CID 134928532) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is ethyl (3S,4R)-2-benzyl-4-propylsulfanylcarbonyl-1,2-oxazolidine-3-carboxylate.
| Compound Name | ethyl (3S,4R)-2-benzyl-4-propylsulfanylcarbonyl-1,2-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134928532 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | ethyl (3S,4R)-2-benzyl-4-propylsulfanylcarbonyl-1,2-oxazolidine-3-carboxylate |
| SMILES | CCCSC(=O)[C@H]1CON(Cc2ccccc2)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C17H23NO4S/c1-3-10-23-17(20)14-12-22-18(15(14)16(19)21-4-2)11-13-8-6-5-7-9-13/h5-9,14-15H,3-4,10-12H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | OPCMWOOCLBYTRE-GJZGRUSLSA-N |
| XLogP | 2.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|