About (2R,3R)-2-ethyl-2,3-dimethylthiirane
(2R,3R)-2-ethyl-2,3-dimethylthiirane (PubChem CID 134928594) has the molecular formula C6H12S
and a molecular weight of 116.23 g/mol. Its IUPAC name is (2R,3R)-2-ethyl-2,3-dimethylthiirane.
Molecular Properties
| Compound Name | (2R,3R)-2-ethyl-2,3-dimethylthiirane |
| PubChem CID | 134928594 |
| Molecular Formula | C6H12S |
| Molecular Weight | 116.23 g/mol |
| Exact Mass | 116.07 |
| IUPAC Name | (2R,3R)-2-ethyl-2,3-dimethylthiirane |
| SMILES | CC[C@@]1(C)S[C@@H]1C |
| InChI | InChI=1S/C6H12S/c1-4-6(3)5(2)7-6/h5H,4H2,1-3H3/t5-,6-/m1/s1 |
| InChIKey | LVZSDFKBNBZBMW-PHDIDXHHSA-N |
| XLogP | 2.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2-ethyl-2,3-dimethylthiirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2-ethyl-2,3-dimethylthiirane?
The IUPAC name of (2R,3R)-2-ethyl-2,3-dimethylthiirane (CID 134928594) is (2R,3R)-2-ethyl-2,3-dimethylthiirane.
What is the SMILES notation for (2R,3R)-2-ethyl-2,3-dimethylthiirane?
The canonical SMILES for (2R,3R)-2-ethyl-2,3-dimethylthiirane is CC[C@@]1(C)S[C@@H]1C.
What is the InChIKey of (2R,3R)-2-ethyl-2,3-dimethylthiirane?
The InChIKey is LVZSDFKBNBZBMW-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H12S/c1-4-6(3)5(2)7-6/h5H,4H2,1-3H3/t5-,6-/m1/s1.
What are the key properties of (2R,3R)-2-ethyl-2,3-dimethylthiirane?
(2R,3R)-2-ethyl-2,3-dimethylthiirane has a molecular weight of 116.23 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2-ethyl-2,3-dimethylthiirane is sourced from PubChem (CID 134928594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).