About 6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane
6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane (PubChem CID 134928662) has the molecular formula C18H20O3
and a molecular weight of 284.36 g/mol. Its IUPAC name is 6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane.
Molecular Properties
| Compound Name | 6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane |
| PubChem CID | 134928662 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane |
| SMILES | C=CC1(C)OOC(c2cccc3ccccc23)OC1CC |
| InChI | InChI=1S/C18H20O3/c1-4-16-18(3,5-2)21-20-17(19-16)15-12-8-10-13-9-6-7-11-14(13)15/h5-12,16-17H,2,4H2,1,3H3 |
| InChIKey | VFTLTNLMONIXSX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane?
The IUPAC name of 6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane (CID 134928662) is 6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane.
What is the SMILES notation for 6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane?
The canonical SMILES for 6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane is C=CC1(C)OOC(c2cccc3ccccc23)OC1CC.
What is the InChIKey of 6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane?
The InChIKey is VFTLTNLMONIXSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3/c1-4-16-18(3,5-2)21-20-17(19-16)15-12-8-10-13-9-6-7-11-14(13)15/h5-12,16-17H,2,4H2,1,3H3.
What are the key properties of 6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane?
6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane has a molecular weight of 284.36 g/mol, XLogP of 4.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-5-ethyl-6-methyl-3-naphthalen-1-yl-1,2,4-trioxane is sourced from PubChem (CID 134928662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).