C29H29NO6 — CID 134928778
ethyl (4aR,8aS)-6-benzyl-8a-hydroxy-5-oxo-3,3-diphenyl-7,8-dihydro-4H-[1,2]dioxino[4,3-c]pyridine-4a-carboxylate (PubChem CID 134928778) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is ethyl (4aR,8aS)-6-benzyl-8a-hydroxy-5-oxo-3,3-diphenyl-7,8-dihydro-4H-[1,2]dioxino[4,3-c]pyridine-4a-carboxylate.
| Compound Name | ethyl (4aR,8aS)-6-benzyl-8a-hydroxy-5-oxo-3,3-diphenyl-7,8-dihydro-4H-[1,2]dioxino[4,3-c]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 134928778 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | ethyl (4aR,8aS)-6-benzyl-8a-hydroxy-5-oxo-3,3-diphenyl-7,8-dihydro-4H-[1,2]dioxino[4,3-c]pyridine-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12CC(c3ccccc3)(c3ccccc3)OO[C@@]1(O)CCN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C29H29NO6/c1-2-34-26(32)27-21-28(23-14-8-4-9-15-23,24-16-10-5-11-17-24)35-36-29(27,33)18-19-30(25(27)31)20-22-12-6-3-7-13-22/h3-17,33H,2,18-21H2,1H3/t27-,29+/m1/s1 |
| InChIKey | JUMTZKBIWORDJU-PXJZQJOASA-N |
| XLogP | 3.95 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|