About 3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane
3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane (PubChem CID 134928783) has the molecular formula C12H16O6
and a molecular weight of 256.25 g/mol. Its IUPAC name is 3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane.
Molecular Properties
| Compound Name | 3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane |
| PubChem CID | 134928783 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane |
| SMILES | CC(C)(OC(OO)c1ccccc1)C1OCOO1 |
| InChI | InChI=1S/C12H16O6/c1-12(2,11-14-8-15-18-11)16-10(17-13)9-6-4-3-5-7-9/h3-7,10-11,13H,8H2,1-2H3 |
| InChIKey | XKVMDOPRXAGBRX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane?
The IUPAC name of 3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane (CID 134928783) is 3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane.
What is the SMILES notation for 3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane?
The canonical SMILES for 3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane is CC(C)(OC(OO)c1ccccc1)C1OCOO1.
What is the InChIKey of 3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane?
The InChIKey is XKVMDOPRXAGBRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O6/c1-12(2,11-14-8-15-18-11)16-10(17-13)9-6-4-3-5-7-9/h3-7,10-11,13H,8H2,1-2H3.
What are the key properties of 3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane?
3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane has a molecular weight of 256.25 g/mol, XLogP of 2.23, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[hydroperoxy(phenyl)methoxy]propan-2-yl]-1,2,4-trioxolane is sourced from PubChem (CID 134928783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).