C20H29NOS — CID 134928903
(1R,4S)-1,7,7-trimethyl-3-[[(1S)-1-phenylbut-3-enyl]amino]sulfanylbicyclo[2.2.1]heptan-2-ol (PubChem CID 134928903) has the molecular formula C20H29NOS and a molecular weight of 331.52 g/mol. Its IUPAC name is (1R,4S)-1,7,7-trimethyl-3-[[(1S)-1-phenylbut-3-enyl]amino]sulfanylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,4S)-1,7,7-trimethyl-3-[[(1S)-1-phenylbut-3-enyl]amino]sulfanylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 134928903 |
| Molecular Formula | C20H29NOS |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | (1R,4S)-1,7,7-trimethyl-3-[[(1S)-1-phenylbut-3-enyl]amino]sulfanylbicyclo[2.2.1]heptan-2-ol |
| SMILES | C=CC[C@H](NSC1C(O)[C@]2(C)CC[C@H]1C2(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H29NOS/c1-5-9-16(14-10-7-6-8-11-14)21-23-17-15-12-13-20(4,18(17)22)19(15,2)3/h5-8,10-11,15-18,21-22H,1,9,12-13H2,2-4H3/t15-,16+,17?,18?,20+/m1/s1 |
| InChIKey | OOGNUDITOATLQJ-FOBNLEPYSA-N |
| XLogP | 4.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|