About [2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate
[2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate (PubChem CID 134929071) has the molecular formula C11H26O4S2
and a molecular weight of 286.46 g/mol. Its IUPAC name is [2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate.
Molecular Properties
| Compound Name | [2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate |
| PubChem CID | 134929071 |
| Molecular Formula | C11H26O4S2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | [2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate |
| SMILES | CCCCCCC(O)CS(C)(C)OS(C)(=O)=O |
| InChI | InChI=1S/C11H26O4S2/c1-5-6-7-8-9-11(12)10-16(2,3)15-17(4,13)14/h11-12H,5-10H2,1-4H3 |
| InChIKey | YXDWYZSZYBWKPS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate?
The IUPAC name of [2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate (CID 134929071) is [2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate.
What is the SMILES notation for [2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate?
The canonical SMILES for [2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate is CCCCCCC(O)CS(C)(C)OS(C)(=O)=O.
What is the InChIKey of [2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate?
The InChIKey is YXDWYZSZYBWKPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26O4S2/c1-5-6-7-8-9-11(12)10-16(2,3)15-17(4,13)14/h11-12H,5-10H2,1-4H3.
What are the key properties of [2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate?
[2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate has a molecular weight of 286.46 g/mol, XLogP of 2.27, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-hydroxyoctyl(dimethyl)-λ4-sulfanyl] methanesulfonate is sourced from PubChem (CID 134929071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).