C9H10O4 — CID 134929147
methyl (1R,2S,4S,5S)-6,7-dioxatricyclo[3.2.2.02,4]non-8-ene-3-carboxylate (PubChem CID 134929147) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is methyl (1R,2S,4S,5S)-6,7-dioxatricyclo[3.2.2.02,4]non-8-ene-3-carboxylate.
| Compound Name | methyl (1R,2S,4S,5S)-6,7-dioxatricyclo[3.2.2.02,4]non-8-ene-3-carboxylate |
|---|---|
| PubChem CID | 134929147 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | methyl (1R,2S,4S,5S)-6,7-dioxatricyclo[3.2.2.02,4]non-8-ene-3-carboxylate |
| SMILES | COC(=O)C1[C@@H]2[C@@H]1[C@H]1C=C[C@@H]2OO1 |
| InChI | InChI=1S/C9H10O4/c1-11-9(10)8-6-4-2-3-5(7(6)8)13-12-4/h2-8H,1H3/t4-,5+,6-,7-,8?/m0/s1 |
| InChIKey | QDIDWXLMGLOAEP-NHLUQKHUSA-N |
| XLogP | 0.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|