C12H14O2 — CID 134929154
(3R,6R)-3-methyl-6-(4-methylphenyl)-3,6-dihydro-1,2-dioxine (PubChem CID 134929154) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (3R,6R)-3-methyl-6-(4-methylphenyl)-3,6-dihydro-1,2-dioxine.
| Compound Name | (3R,6R)-3-methyl-6-(4-methylphenyl)-3,6-dihydro-1,2-dioxine |
|---|---|
| PubChem CID | 134929154 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (3R,6R)-3-methyl-6-(4-methylphenyl)-3,6-dihydro-1,2-dioxine |
| SMILES | Cc1ccc([C@H]2C=C[C@@H](C)OO2)cc1 |
| InChI | InChI=1S/C12H14O2/c1-9-3-6-11(7-4-9)12-8-5-10(2)13-14-12/h3-8,10,12H,1-2H3/t10-,12-/m1/s1 |
| InChIKey | INRLWGNIWSXZLM-ZYHUDNBSSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|