C12H10O2S — CID 134929295
4-hydroxy-7,8-dihydro-6H-cyclopenta[e][1]benzothiole-5-carbaldehyde (PubChem CID 134929295) has the molecular formula C12H10O2S and a molecular weight of 218.28 g/mol. Its IUPAC name is 4-hydroxy-7,8-dihydro-6H-cyclopenta[e][1]benzothiole-5-carbaldehyde.
| Compound Name | 4-hydroxy-7,8-dihydro-6H-cyclopenta[e][1]benzothiole-5-carbaldehyde |
|---|---|
| PubChem CID | 134929295 |
| Molecular Formula | C12H10O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 4-hydroxy-7,8-dihydro-6H-cyclopenta[e][1]benzothiole-5-carbaldehyde |
| SMILES | O=Cc1c2c(c3ccsc3c1O)CCC2 |
| InChI | InChI=1S/C12H10O2S/c13-6-10-8-3-1-2-7(8)9-4-5-15-12(9)11(10)14/h4-6,14H,1-3H2 |
| InChIKey | FKHWAXCRIPCKAT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|