C15H17NOS — CID 134929453
N-[(1S,2R,4S)-2-phenylsulfanyl-2-bicyclo[2.2.1]hept-5-enyl]acetamide (PubChem CID 134929453) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is N-[(1S,2R,4S)-2-phenylsulfanyl-2-bicyclo[2.2.1]hept-5-enyl]acetamide.
| Compound Name | N-[(1S,2R,4S)-2-phenylsulfanyl-2-bicyclo[2.2.1]hept-5-enyl]acetamide |
|---|---|
| PubChem CID | 134929453 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-[(1S,2R,4S)-2-phenylsulfanyl-2-bicyclo[2.2.1]hept-5-enyl]acetamide |
| SMILES | CC(=O)N[C@@]1(Sc2ccccc2)C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C15H17NOS/c1-11(17)16-15(10-12-7-8-13(15)9-12)18-14-5-3-2-4-6-14/h2-8,12-13H,9-10H2,1H3,(H,16,17)/t12-,13+,15+/m0/s1 |
| InChIKey | HZGRLCYXHDKDQD-GZBFAFLISA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|