C27H38O5Si — CID 134929456
(4R)-6-[tert-butyl(diphenyl)silyl]oxy-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-hydroxyhexan-2-one (PubChem CID 134929456) has the molecular formula C27H38O5Si and a molecular weight of 470.68 g/mol. Its IUPAC name is (4R)-6-[tert-butyl(diphenyl)silyl]oxy-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-hydroxyhexan-2-one.
| Compound Name | (4R)-6-[tert-butyl(diphenyl)silyl]oxy-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-hydroxyhexan-2-one |
|---|---|
| PubChem CID | 134929456 |
| Molecular Formula | C27H38O5Si |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | (4R)-6-[tert-butyl(diphenyl)silyl]oxy-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-hydroxyhexan-2-one |
| SMILES | CC1(C)OCC(CC(=O)C[C@H](O)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C27H38O5Si/c1-26(2,3)33(24-12-8-6-9-13-24,25-14-10-7-11-15-25)31-17-16-21(28)18-22(29)19-23-20-30-27(4,5)32-23/h6-15,21,23,28H,16-20H2,1-5H3/t21-,23?/m1/s1 |
| InChIKey | CKNWYLZMRXLYKS-FKHAVUOCSA-N |
| XLogP | 3.81 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|