C7H14S2 — CID 134929754
trans-(2S,3S)-2,3-dimethyl-1,1-bis(methylsulfanyl)cyclopropane (PubChem CID 134929754) has the molecular formula C7H14S2 and a molecular weight of 162.32 g/mol. Its IUPAC name is trans-(2S,3S)-2,3-dimethyl-1,1-bis(methylsulfanyl)cyclopropane.
| Compound Name | trans-(2S,3S)-2,3-dimethyl-1,1-bis(methylsulfanyl)cyclopropane |
|---|---|
| PubChem CID | 134929754 |
| Molecular Formula | C7H14S2 |
| Molecular Weight | 162.32 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | trans-(2S,3S)-2,3-dimethyl-1,1-bis(methylsulfanyl)cyclopropane |
| SMILES | CSC1(SC)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C7H14S2/c1-5-6(2)7(5,8-3)9-4/h5-6H,1-4H3/t5-,6-/m0/s1 |
| InChIKey | OOEMNMXWNBEXSK-WDSKDSINSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|