C17H24O4 — CID 134930092
(3E,7S,11E,13S,15S)-15-methoxy-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-diene-2,5-dione (PubChem CID 134930092) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3E,7S,11E,13S,15S)-15-methoxy-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-diene-2,5-dione.
| Compound Name | (3E,7S,11E,13S,15S)-15-methoxy-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-diene-2,5-dione |
|---|---|
| PubChem CID | 134930092 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (3E,7S,11E,13S,15S)-15-methoxy-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-diene-2,5-dione |
| SMILES | CO[C@@H]1CC2C(=O)/C=C/C(=O)O[C@@H](C)CCC/C=C/[C@@H]2C1 |
| InChI | InChI=1S/C17H24O4/c1-12-6-4-3-5-7-13-10-14(20-2)11-15(13)16(18)8-9-17(19)21-12/h5,7-9,12-15H,3-4,6,10-11H2,1-2H3/b7-5+,9-8+/t12-,13+,14-,15?/m0/s1 |
| InChIKey | HIROFTXITYAFBO-FJCGEVSSSA-N |
| XLogP | 2.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|