About 7-bromo-2-pentyl-2,3-dihydro-1-benzofuran
7-bromo-2-pentyl-2,3-dihydro-1-benzofuran (PubChem CID 134930098) has the molecular formula C13H17BrO
and a molecular weight of 269.18 g/mol. Its IUPAC name is 7-bromo-2-pentyl-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 7-bromo-2-pentyl-2,3-dihydro-1-benzofuran |
| PubChem CID | 134930098 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 7-bromo-2-pentyl-2,3-dihydro-1-benzofuran |
| SMILES | CCCCCC1Cc2cccc(Br)c2O1 |
| InChI | InChI=1S/C13H17BrO/c1-2-3-4-7-11-9-10-6-5-8-12(14)13(10)15-11/h5-6,8,11H,2-4,7,9H2,1H3 |
| InChIKey | CVFQRMDPRUTBJL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-2-pentyl-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-pentyl-2,3-dihydro-1-benzofuran?
The IUPAC name of 7-bromo-2-pentyl-2,3-dihydro-1-benzofuran (CID 134930098) is 7-bromo-2-pentyl-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 7-bromo-2-pentyl-2,3-dihydro-1-benzofuran?
The canonical SMILES for 7-bromo-2-pentyl-2,3-dihydro-1-benzofuran is CCCCCC1Cc2cccc(Br)c2O1.
What is the InChIKey of 7-bromo-2-pentyl-2,3-dihydro-1-benzofuran?
The InChIKey is CVFQRMDPRUTBJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrO/c1-2-3-4-7-11-9-10-6-5-8-12(14)13(10)15-11/h5-6,8,11H,2-4,7,9H2,1H3.
What are the key properties of 7-bromo-2-pentyl-2,3-dihydro-1-benzofuran?
7-bromo-2-pentyl-2,3-dihydro-1-benzofuran has a molecular weight of 269.18 g/mol, XLogP of 4.33, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-pentyl-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 134930098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).