C19H20O4S2 — CID 134930179
(3aR,6aR)-4-[bis(phenylsulfanyl)methyl]-2-methyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol (PubChem CID 134930179) has the molecular formula C19H20O4S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (3aR,6aR)-4-[bis(phenylsulfanyl)methyl]-2-methyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol.
| Compound Name | (3aR,6aR)-4-[bis(phenylsulfanyl)methyl]-2-methyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 134930179 |
| Molecular Formula | C19H20O4S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | (3aR,6aR)-4-[bis(phenylsulfanyl)methyl]-2-methyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ol |
| SMILES | CC1O[C@@H]2[C@@H](COC2(O)C(Sc2ccccc2)Sc2ccccc2)O1 |
| InChI | InChI=1S/C19H20O4S2/c1-13-22-16-12-21-19(20,17(16)23-13)18(24-14-8-4-2-5-9-14)25-15-10-6-3-7-11-15/h2-11,13,16-18,20H,12H2,1H3/t13?,16-,17-,19?/m1/s1 |
| InChIKey | XNUCSCNVZLESIQ-DONOWJBHSA-N |
| XLogP | 3.75 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|