C15H17BrO3S — CID 134930456
(3aS,4S,5S,7aS)-7-bromo-2,2-dimethyl-5-phenylsulfanyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol (PubChem CID 134930456) has the molecular formula C15H17BrO3S and a molecular weight of 357.27 g/mol. Its IUPAC name is (3aS,4S,5S,7aS)-7-bromo-2,2-dimethyl-5-phenylsulfanyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aS,4S,5S,7aS)-7-bromo-2,2-dimethyl-5-phenylsulfanyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 134930456 |
| Molecular Formula | C15H17BrO3S |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | (3aS,4S,5S,7aS)-7-bromo-2,2-dimethyl-5-phenylsulfanyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
| SMILES | CC1(C)O[C@H]2[C@H](O)[C@@H](Sc3ccccc3)C=C(Br)[C@H]2O1 |
| InChI | InChI=1S/C15H17BrO3S/c1-15(2)18-13-10(16)8-11(12(17)14(13)19-15)20-9-6-4-3-5-7-9/h3-8,11-14,17H,1-2H3/t11-,12+,13+,14-/m0/s1 |
| InChIKey | SMJLSTWVMVDQOZ-DGAVXFQQSA-N |
| XLogP | 3.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |