C15H28O8Si — CID 134930480
2-trimethylsilylethoxymethyl (1S,2S,3S,4S,5R)-2-acetyloxy-3,4,5-trihydroxycyclohexane-1-carboxylate (PubChem CID 134930480) has the molecular formula C15H28O8Si and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-trimethylsilylethoxymethyl (1S,2S,3S,4S,5R)-2-acetyloxy-3,4,5-trihydroxycyclohexane-1-carboxylate.
| Compound Name | 2-trimethylsilylethoxymethyl (1S,2S,3S,4S,5R)-2-acetyloxy-3,4,5-trihydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 134930480 |
| Molecular Formula | C15H28O8Si |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-trimethylsilylethoxymethyl (1S,2S,3S,4S,5R)-2-acetyloxy-3,4,5-trihydroxycyclohexane-1-carboxylate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@@H](O)[C@H](O)C[C@@H]1C(=O)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C15H28O8Si/c1-9(16)23-14-10(7-11(17)12(18)13(14)19)15(20)22-8-21-5-6-24(2,3)4/h10-14,17-19H,5-8H2,1-4H3/t10-,11+,12-,13-,14-/m0/s1 |
| InChIKey | MCWAIZJRENISLL-NDKCEZKHSA-N |
| XLogP | -0.12 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|