C28H54O8Si — CID 134930513
(2R)-2-[(2S,5R)-5-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]oxolan-2-yl]-4-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]butan-2-ol (PubChem CID 134930513) has the molecular formula C28H54O8Si and a molecular weight of 546.82 g/mol. Its IUPAC name is (2R)-2-[(2S,5R)-5-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]oxolan-2-yl]-4-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]butan-2-ol.
| Compound Name | (2R)-2-[(2S,5R)-5-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]oxolan-2-yl]-4-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]butan-2-ol |
|---|---|
| PubChem CID | 134930513 |
| Molecular Formula | C28H54O8Si |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | (2R)-2-[(2S,5R)-5-[(2S,5S)-5-[(2R)-2-hydroxy-1-(2-trimethylsilylethoxymethoxy)propan-2-yl]oxolan-2-yl]oxolan-2-yl]-4-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]butan-2-ol |
| SMILES | CC1(C)O[C@H](CC[C@@](C)(O)[C@@H]2CC[C@H]([C@@H]3CC[C@@H]([C@](C)(O)COCOCC[Si](C)(C)C)O3)O2)C(C)(C)O1 |
| InChI | InChI=1S/C28H54O8Si/c1-25(2)22(35-26(3,4)36-25)14-15-27(5,29)23-12-10-20(33-23)21-11-13-24(34-21)28(6,30)18-32-19-31-16-17-37(7,8)9/h20-24,29-30H,10-19H2,1-9H3/t20-,21+,22-,23+,24+,27-,28-/m1/s1 |
| InChIKey | VATQGCMQRGJWMC-IEIVMEHVSA-N |
| XLogP | 4.62 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|