C25H32O4Si — CID 134930518
2-trimethylsilylethyl (2R,3R,6S)-2,6-dibenzyl-4-oxooxane-3-carboxylate (PubChem CID 134930518) has the molecular formula C25H32O4Si and a molecular weight of 424.61 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2R,3R,6S)-2,6-dibenzyl-4-oxooxane-3-carboxylate.
| Compound Name | 2-trimethylsilylethyl (2R,3R,6S)-2,6-dibenzyl-4-oxooxane-3-carboxylate |
|---|---|
| PubChem CID | 134930518 |
| Molecular Formula | C25H32O4Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-trimethylsilylethyl (2R,3R,6S)-2,6-dibenzyl-4-oxooxane-3-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)[C@H]1C(=O)C[C@H](Cc2ccccc2)O[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C25H32O4Si/c1-30(2,3)15-14-28-25(27)24-22(26)18-21(16-19-10-6-4-7-11-19)29-23(24)17-20-12-8-5-9-13-20/h4-13,21,23-24H,14-18H2,1-3H3/t21-,23+,24-/m0/s1 |
| InChIKey | JXDUAPKPUNTGJF-QTJGBDASSA-N |
| XLogP | 4.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|