C17H25F2O6PS — CID 134930592
(1S,2S,3S)-2-(benzenesulfonyl)-3-[diethoxyphosphoryl(difluoro)methyl]cyclohexan-1-ol (PubChem CID 134930592) has the molecular formula C17H25F2O6PS and a molecular weight of 426.42 g/mol. Its IUPAC name is (1S,2S,3S)-2-(benzenesulfonyl)-3-[diethoxyphosphoryl(difluoro)methyl]cyclohexan-1-ol.
| Compound Name | (1S,2S,3S)-2-(benzenesulfonyl)-3-[diethoxyphosphoryl(difluoro)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 134930592 |
| Molecular Formula | C17H25F2O6PS |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (1S,2S,3S)-2-(benzenesulfonyl)-3-[diethoxyphosphoryl(difluoro)methyl]cyclohexan-1-ol |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@@H]1CCC[C@H](O)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H25F2O6PS/c1-3-24-26(21,25-4-2)17(18,19)14-11-8-12-15(20)16(14)27(22,23)13-9-6-5-7-10-13/h5-7,9-10,14-16,20H,3-4,8,11-12H2,1-2H3/t14-,15+,16+/m1/s1 |
| InChIKey | VQNFYVYDTWKGLE-PMPSAXMXSA-N |
| XLogP | 3.85 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|