C16H29NO4 — CID 134930681
tert-butyl (3R)-3-[(1S)-1-hydroxypropyl]-1-oxa-4-azaspiro[4.5]decane-4-carboxylate (PubChem CID 134930681) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(1S)-1-hydroxypropyl]-1-oxa-4-azaspiro[4.5]decane-4-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(1S)-1-hydroxypropyl]-1-oxa-4-azaspiro[4.5]decane-4-carboxylate |
|---|---|
| PubChem CID | 134930681 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | tert-butyl (3R)-3-[(1S)-1-hydroxypropyl]-1-oxa-4-azaspiro[4.5]decane-4-carboxylate |
| SMILES | CC[C@H](O)[C@H]1COC2(CCCCC2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO4/c1-5-13(18)12-11-20-16(9-7-6-8-10-16)17(12)14(19)21-15(2,3)4/h12-13,18H,5-11H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | DUNZJCXEBCMUPB-OLZOCXBDSA-N |
| XLogP | 3.05 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |