C21H23NO7 — CID 134930695
(2R,4aR,6R,7R,8S,8aS)-6-methoxy-8-nitro-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 134930695) has the molecular formula C21H23NO7 and a molecular weight of 401.42 g/mol. Its IUPAC name is (2R,4aR,6R,7R,8S,8aS)-6-methoxy-8-nitro-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6R,7R,8S,8aS)-6-methoxy-8-nitro-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 134930695 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (2R,4aR,6R,7R,8S,8aS)-6-methoxy-8-nitro-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H]([N+](=O)[O-])[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H23NO7/c1-25-21-19(26-12-14-8-4-2-5-9-14)17(22(23)24)18-16(28-21)13-27-20(29-18)15-10-6-3-7-11-15/h2-11,16-21H,12-13H2,1H3/t16-,17+,18-,19-,20-,21-/m1/s1 |
| InChIKey | HPVDYGSKELHJHX-KXXIFBCNSA-N |
| XLogP | 2.70 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|