C12H22O4S — CID 134930714
methyl (2S,3R)-3-tert-butylsulfanylcarbonyl-2-hydroxy-2-methylpentanoate (PubChem CID 134930714) has the molecular formula C12H22O4S and a molecular weight of 262.37 g/mol. Its IUPAC name is methyl (2S,3R)-3-tert-butylsulfanylcarbonyl-2-hydroxy-2-methylpentanoate.
| Compound Name | methyl (2S,3R)-3-tert-butylsulfanylcarbonyl-2-hydroxy-2-methylpentanoate |
|---|---|
| PubChem CID | 134930714 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl (2S,3R)-3-tert-butylsulfanylcarbonyl-2-hydroxy-2-methylpentanoate |
| SMILES | CC[C@@H](C(=O)SC(C)(C)C)[C@](C)(O)C(=O)OC |
| InChI | InChI=1S/C12H22O4S/c1-7-8(9(13)17-11(2,3)4)12(5,15)10(14)16-6/h8,15H,7H2,1-6H3/t8-,12-/m0/s1 |
| InChIKey | SWDPYXAVXRQPDA-UFBFGSQYSA-N |
| XLogP | 1.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|