About 6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one
6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 134930812) has the molecular formula C17H30O4
and a molecular weight of 298.42 g/mol. Its IUPAC name is 6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | 6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one |
| PubChem CID | 134930812 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CCCCCCCCC[C@H](O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C17H30O4/c1-4-5-6-7-8-9-10-11-14(18)12-15-13-16(19)21-17(2,3)20-15/h13-14,18H,4-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | YRMRBHUIAAKSAR-AWEZNQCLSA-N |
| XLogP | 4.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one?
The IUPAC name of 6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one (CID 134930812) is 6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one.
What is the SMILES notation for 6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one?
The canonical SMILES for 6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one is CCCCCCCCC[C@H](O)CC1=CC(=O)OC(C)(C)O1.
What is the InChIKey of 6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one?
The InChIKey is YRMRBHUIAAKSAR-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H30O4/c1-4-5-6-7-8-9-10-11-14(18)12-15-13-16(19)21-17(2,3)20-15/h13-14,18H,4-12H2,1-3H3/t14-/m0/s1.
What are the key properties of 6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one?
6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one has a molecular weight of 298.42 g/mol, XLogP of 4.07, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2S)-2-hydroxyundecyl]-2,2-dimethyl-1,3-dioxin-4-one is sourced from PubChem (CID 134930812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).