C15H19NO3 — CID 134930848
(1R)-1-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]but-3-en-1-ol (PubChem CID 134930848) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (1R)-1-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]but-3-en-1-ol.
| Compound Name | (1R)-1-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 134930848 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (1R)-1-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]but-3-en-1-ol |
| SMILES | C=CC[C@@H](O)C1=N[C@@H](COC)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C15H19NO3/c1-3-7-13(17)15-16-12(10-18-2)14(19-15)11-8-5-4-6-9-11/h3-6,8-9,12-14,17H,1,7,10H2,2H3/t12-,13+,14-/m0/s1 |
| InChIKey | ZVZMTMYQCYPRNL-MJBXVCDLSA-N |
| XLogP | 2.11 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|