About 2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal
2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal (PubChem CID 134930857) has the molecular formula C19H36O3Si
and a molecular weight of 340.58 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal.
Molecular Properties
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal |
| PubChem CID | 134930857 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal |
| SMILES | C=CC(C)(CCC=C(C)C)C(C=O)(OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-11-18(7,14-12-13-16(2)3)19(15-20,21-8)22-23(9,10)17(4,5)6/h11,13,15H,1,12,14H2,2-10H3 |
| InChIKey | YALXAWSADOXIRF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal?
The IUPAC name of 2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal (CID 134930857) is 2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal.
What is the SMILES notation for 2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal?
The canonical SMILES for 2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal is C=CC(C)(CCC=C(C)C)C(C=O)(OC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal?
The InChIKey is YALXAWSADOXIRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O3Si/c1-11-18(7,14-12-13-16(2)3)19(15-20,21-8)22-23(9,10)17(4,5)6/h11,13,15H,1,12,14H2,2-10H3.
What are the key properties of 2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal?
2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal has a molecular weight of 340.58 g/mol, XLogP of 5.49, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-methoxy-3,7-dimethyloct-6-enal is sourced from PubChem (CID 134930857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).