C19H33NOSi2 — CID 134930871
(3S,4S)-4-[benzyl(trimethylsilylmethyl)amino]-1-trimethylsilylpent-1-yn-3-ol (PubChem CID 134930871) has the molecular formula C19H33NOSi2 and a molecular weight of 347.65 g/mol. Its IUPAC name is (3S,4S)-4-[benzyl(trimethylsilylmethyl)amino]-1-trimethylsilylpent-1-yn-3-ol.
| Compound Name | (3S,4S)-4-[benzyl(trimethylsilylmethyl)amino]-1-trimethylsilylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 134930871 |
| Molecular Formula | C19H33NOSi2 |
| Molecular Weight | 347.65 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | (3S,4S)-4-[benzyl(trimethylsilylmethyl)amino]-1-trimethylsilylpent-1-yn-3-ol |
| SMILES | C[C@@H]([C@@H](O)C#C[Si](C)(C)C)N(Cc1ccccc1)C[Si](C)(C)C |
| InChI | InChI=1S/C19H33NOSi2/c1-17(19(21)13-14-22(2,3)4)20(16-23(5,6)7)15-18-11-9-8-10-12-18/h8-12,17,19,21H,15-16H2,1-7H3/t17-,19-/m0/s1 |
| InChIKey | LOYUBLZFOIMEOW-HKUYNNGSSA-N |
| XLogP | 4.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|