C19H32O6 — CID 134930890
(5S)-5-[(2R,5S)-5-[(2R,3S,5S)-5-[(1R,2S)-1,3-dihydroxy-2-methylpropyl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-5-methyloxolan-2-one (PubChem CID 134930890) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is (5S)-5-[(2R,5S)-5-[(2R,3S,5S)-5-[(1R,2S)-1,3-dihydroxy-2-methylpropyl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-5-methyloxolan-2-one.
| Compound Name | (5S)-5-[(2R,5S)-5-[(2R,3S,5S)-5-[(1R,2S)-1,3-dihydroxy-2-methylpropyl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 134930890 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (5S)-5-[(2R,5S)-5-[(2R,3S,5S)-5-[(1R,2S)-1,3-dihydroxy-2-methylpropyl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-5-methyloxolan-2-one |
| SMILES | C[C@@H](CO)[C@@H](O)[C@@H]1C[C@H](C)[C@H]([C@]2(C)CC[C@H]([C@]3(C)CCC(=O)O3)O2)O1 |
| InChI | InChI=1S/C19H32O6/c1-11-9-13(16(22)12(2)10-20)23-17(11)19(4)7-5-14(24-19)18(3)8-6-15(21)25-18/h11-14,16-17,20,22H,5-10H2,1-4H3/t11-,12-,13-,14+,16+,17+,18-,19-/m0/s1 |
| InChIKey | AACAUTYRKLHPSV-ZMFCCABISA-N |
| XLogP | 1.80 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |