C10H18O5 — CID 134930923
(E,2R,3S)-1,3,5-trimethoxy-5-(oxiran-2-yl)pent-4-en-2-ol (PubChem CID 134930923) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is (E,2R,3S)-1,3,5-trimethoxy-5-(oxiran-2-yl)pent-4-en-2-ol.
| Compound Name | (E,2R,3S)-1,3,5-trimethoxy-5-(oxiran-2-yl)pent-4-en-2-ol |
|---|---|
| PubChem CID | 134930923 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (E,2R,3S)-1,3,5-trimethoxy-5-(oxiran-2-yl)pent-4-en-2-ol |
| SMILES | COC[C@@H](O)[C@H](/C=C(/OC)C1CO1)OC |
| InChI | InChI=1S/C10H18O5/c1-12-5-7(11)8(13-2)4-9(14-3)10-6-15-10/h4,7-8,10-11H,5-6H2,1-3H3/b9-4+/t7-,8+,10?/m1/s1 |
| InChIKey | NDQNWZSVTNBSNI-KCBLIUJESA-N |
| XLogP | -0.06 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|