C15H27NO5 — CID 134930935
(2R,3S)-2-hydroxy-1-[(2S)-2-(2-methoxyethoxymethoxymethyl)pyrrolidin-1-yl]-3-methylpent-4-en-1-one (PubChem CID 134930935) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is (2R,3S)-2-hydroxy-1-[(2S)-2-(2-methoxyethoxymethoxymethyl)pyrrolidin-1-yl]-3-methylpent-4-en-1-one.
| Compound Name | (2R,3S)-2-hydroxy-1-[(2S)-2-(2-methoxyethoxymethoxymethyl)pyrrolidin-1-yl]-3-methylpent-4-en-1-one |
|---|---|
| PubChem CID | 134930935 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | (2R,3S)-2-hydroxy-1-[(2S)-2-(2-methoxyethoxymethoxymethyl)pyrrolidin-1-yl]-3-methylpent-4-en-1-one |
| SMILES | C=C[C@H](C)[C@@H](O)C(=O)N1CCC[C@H]1COCOCCOC |
| InChI | InChI=1S/C15H27NO5/c1-4-12(2)14(17)15(18)16-7-5-6-13(16)10-21-11-20-9-8-19-3/h4,12-14,17H,1,5-11H2,2-3H3/t12-,13-,14+/m0/s1 |
| InChIKey | UHYHGHGKDHIQLM-MELADBBJSA-N |
| XLogP | 0.80 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|